C15H12F2N2O4 — CID 130277859
3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]benzoic acid (PubChem CID 130277859) has the molecular formula C15H12F2N2O4 and a molecular weight of 322.27 g/mol. Its IUPAC name is 3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]benzoic acid.
| Compound Name | 3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 130277859 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-amino-4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methylamino]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1NCc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C15H12F2N2O4/c16-15(17)22-12-3-1-2-9(13(12)23-15)7-19-11-5-4-8(14(20)21)6-10(11)18/h1-6,19H,7,18H2,(H,20,21) |
| InChIKey | KTPCEBLUVIFURS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|