(2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid

C9H7F2NO4 — CID 174208615

IUPAC(2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid
SMILESO=C(O)NCc1cccc2c1OC(F)(F)O2
InChIInChI=1S/C9H7F2NO4/c10-9(11)15-6-3-1-2-5(7(6)16-9)4-12-8(13)14/h1-3,12H,4H2,(H,13,14)
InChIKeyGSYSTFCDKOFKIG-UHFFFAOYSA-N
MW231.15 g/mol
LogP1.78
Rot. Bonds2

About (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid

(2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid (PubChem CID 174208615) has the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. Its IUPAC name is (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid.

Molecular Properties

Compound Name(2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid
PubChem CID174208615
Molecular FormulaC9H7F2NO4
Molecular Weight231.15 g/mol
Exact Mass231.03
IUPAC Name(2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid
SMILESO=C(O)NCc1cccc2c1OC(F)(F)O2
InChIInChI=1S/C9H7F2NO4/c10-9(11)15-6-3-1-2-5(7(6)16-9)4-12-8(13)14/h1-3,12H,4H2,(H,13,14)
InChIKeyGSYSTFCDKOFKIG-UHFFFAOYSA-N
XLogP1.78
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.15
LogP ≤ 51.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid?
The IUPAC name of (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid (CID 174208615) is (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid.
What is the SMILES notation for (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid?
The canonical SMILES for (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid is O=C(O)NCc1cccc2c1OC(F)(F)O2.
What is the InChIKey of (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid?
The InChIKey is GSYSTFCDKOFKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2NO4/c10-9(11)15-6-3-1-2-5(7(6)16-9)4-12-8(13)14/h1-3,12H,4H2,(H,13,14).
What are the key properties of (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid?
(2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid has a molecular weight of 231.15 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluoro-1,3-benzodioxol-4-yl)methylcarbamic acid is sourced from PubChem (CID 174208615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).