C11H12F2N2O3 — CID 171823645
N'-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-N-methylacetohydrazide (PubChem CID 171823645) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is N'-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-N-methylacetohydrazide.
| Compound Name | N'-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-N-methylacetohydrazide |
|---|---|
| PubChem CID | 171823645 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N'-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-N-methylacetohydrazide |
| SMILES | CC(=O)N(C)NCc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C11H12F2N2O3/c1-7(16)15(2)14-6-8-4-3-5-9-10(8)18-11(12,13)17-9/h3-5,14H,6H2,1-2H3 |
| InChIKey | UHUZCWSTQKRIEX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|