C9H7F2NO2S — CID 147511948
2-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanethioamide (PubChem CID 147511948) has the molecular formula C9H7F2NO2S and a molecular weight of 231.22 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanethioamide.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanethioamide |
|---|---|
| PubChem CID | 147511948 |
| Molecular Formula | C9H7F2NO2S |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanethioamide |
| SMILES | NC(=S)Cc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C9H7F2NO2S/c10-9(11)13-6-3-1-2-5(4-7(12)15)8(6)14-9/h1-3H,4H2,(H2,12,15) |
| InChIKey | FJMBMSLNEDLXGV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|