C10H12F2N2O2 — CID 171207838
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)propane-1,3-diamine (PubChem CID 171207838) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)propane-1,3-diamine.
| Compound Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 171207838 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)propane-1,3-diamine |
| SMILES | NCC[C@@H](N)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C10H12F2N2O2/c11-10(12)15-8-3-1-2-6(9(8)16-10)7(14)4-5-13/h1-3,7H,4-5,13-14H2/t7-/m1/s1 |
| InChIKey | OEWMDHAMWLBVFC-SSDOTTSWSA-N |
| XLogP | 1.36 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |