About methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride
methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride (PubChem CID 171249009) has the molecular formula C11H12ClF2NO4
and a molecular weight of 295.67 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride |
| PubChem CID | 171249009 |
| Molecular Formula | C11H12ClF2NO4 |
| Molecular Weight | 295.67 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1cccc2c1OC(F)(F)O2.Cl |
| InChI | InChI=1S/C11H11F2NO4.ClH/c1-16-9(15)5-7(14)6-3-2-4-8-10(6)18-11(12,13)17-8;/h2-4,7H,5,14H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | VQOQKOUXAQFOBQ-OGFXRTJISA-N |
| XLogP | 1.99 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride?
The IUPAC name of methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride (CID 171249009) is methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride.
What is the SMILES notation for methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride?
The canonical SMILES for methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride is COC(=O)C[C@@H](N)c1cccc2c1OC(F)(F)O2.Cl.
What is the InChIKey of methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride?
The InChIKey is VQOQKOUXAQFOBQ-OGFXRTJISA-N. The full InChI is InChI=1S/C11H11F2NO4.ClH/c1-16-9(15)5-7(14)6-3-2-4-8-10(6)18-11(12,13)17-8;/h2-4,7H,5,14H2,1H3;1H/t7-;/m1./s1.
What are the key properties of methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride?
methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride has a molecular weight of 295.67 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate;hydrochloride is sourced from PubChem (CID 171249009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).