About (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride
(3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride (PubChem CID 171260494) has the molecular formula C10H9ClF2N2O2
and a molecular weight of 262.64 g/mol. Its IUPAC name is (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride.
Molecular Properties
| Compound Name | (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride |
| PubChem CID | 171260494 |
| Molecular Formula | C10H9ClF2N2O2 |
| Molecular Weight | 262.64 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride |
| SMILES | Cl.N#CC[C@@H](N)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C10H8F2N2O2.ClH/c11-10(12)15-8-3-1-2-6(9(8)16-10)7(14)4-5-13;/h1-3,7H,4,14H2;1H/t7-;/m1./s1 |
| InChIKey | FHKPYBFYJJHERN-OGFXRTJISA-N |
| XLogP | 2.34 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride?
The IUPAC name of (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride (CID 171260494) is (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride.
What is the SMILES notation for (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride?
The canonical SMILES for (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride is Cl.N#CC[C@@H](N)c1cccc2c1OC(F)(F)O2.
What is the InChIKey of (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride?
The InChIKey is FHKPYBFYJJHERN-OGFXRTJISA-N. The full InChI is InChI=1S/C10H8F2N2O2.ClH/c11-10(12)15-8-3-1-2-6(9(8)16-10)7(14)4-5-13;/h1-3,7H,4,14H2;1H/t7-;/m1./s1.
What are the key properties of (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride?
(3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride has a molecular weight of 262.64 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile;hydrochloride is sourced from PubChem (CID 171260494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).