C13H18ClF2NO2 — CID 171227428
(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)hexan-1-amine;hydrochloride (PubChem CID 171227428) has the molecular formula C13H18ClF2NO2 and a molecular weight of 293.74 g/mol. Its IUPAC name is (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)hexan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227428 |
| Molecular Formula | C13H18ClF2NO2 |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@H](N)c1cccc2c1OC(F)(F)O2.Cl |
| InChI | InChI=1S/C13H17F2NO2.ClH/c1-2-3-4-7-10(16)9-6-5-8-11-12(9)18-13(14,15)17-11;/h5-6,8,10H,2-4,7,16H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | NYKPYDFNWKEBSQ-PPHPATTJSA-N |
| XLogP | 4.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|