About (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride
(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride (PubChem CID 162344369) has the molecular formula C10H10ClF2NO2
and a molecular weight of 249.64 g/mol. Its IUPAC name is (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride |
| PubChem CID | 162344369 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride |
| SMILES | C=C[C@H](N)c1cccc2c1OC(F)(F)O2.Cl |
| InChI | InChI=1S/C10H9F2NO2.ClH/c1-2-7(13)6-4-3-5-8-9(6)15-10(11,12)14-8;/h2-5,7H,1,13H2;1H/t7-;/m0./s1 |
| InChIKey | OBTHWVUGYHVRNE-FJXQXJEOSA-N |
| XLogP | 2.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride?
The IUPAC name of (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride (CID 162344369) is (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride.
What is the SMILES notation for (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride?
The canonical SMILES for (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride is C=C[C@H](N)c1cccc2c1OC(F)(F)O2.Cl.
What is the InChIKey of (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride?
The InChIKey is OBTHWVUGYHVRNE-FJXQXJEOSA-N. The full InChI is InChI=1S/C10H9F2NO2.ClH/c1-2-7(13)6-4-3-5-8-9(6)15-10(11,12)14-8;/h2-5,7H,1,13H2;1H/t7-;/m0./s1.
What are the key properties of (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride?
(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride has a molecular weight of 249.64 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine;hydrochloride is sourced from PubChem (CID 162344369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).