C14H18Cl2F2N2O2 — CID 171291894
1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171291894) has the molecular formula C14H18Cl2F2N2O2 and a molecular weight of 355.21 g/mol. Its IUPAC name is 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171291894 |
| Molecular Formula | C14H18Cl2F2N2O2 |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@H](c1cccc2c1OC(F)(F)O2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H16F2N2O2.2ClH/c1-2-11(18-8-6-17-7-9-18)10-4-3-5-12-13(10)20-14(15,16)19-12;;/h2-5,11,17H,1,6-9H2;2*1H/t11-;;/m1../s1 |
| InChIKey | JERUPVCMXYAFAV-NVJADKKVSA-N |
| XLogP | 2.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|