C16H20F2N2O2 — CID 171180088
1-[(S)-cyclobutyl-(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]piperazine (PubChem CID 171180088) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclobutyl-(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171180088 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[(S)-cyclobutyl-(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]piperazine |
| SMILES | FC1(F)Oc2cccc([C@H](C3CCC3)N3CCNCC3)c2O1 |
| InChI | InChI=1S/C16H20F2N2O2/c17-16(18)21-13-6-2-5-12(15(13)22-16)14(11-3-1-4-11)20-9-7-19-8-10-20/h2,5-6,11,14,19H,1,3-4,7-10H2/t14-/m0/s1 |
| InChIKey | MYAIHOGYOHGUSG-AWEZNQCLSA-N |
| XLogP | 2.75 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |