C17H22F2N2O3 — CID 171279284
1-[(S)-(2,2-difluoro-1,3-benzodioxol-4-yl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171279284) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-[(S)-(2,2-difluoro-1,3-benzodioxol-4-yl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(S)-(2,2-difluoro-1,3-benzodioxol-4-yl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171279284 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(S)-(2,2-difluoro-1,3-benzodioxol-4-yl)-(oxan-4-yl)methyl]piperazine |
| SMILES | FC1(F)Oc2cccc([C@H](C3CCOCC3)N3CCNCC3)c2O1 |
| InChI | InChI=1S/C17H22F2N2O3/c18-17(19)23-14-3-1-2-13(16(14)24-17)15(12-4-10-22-11-5-12)21-8-6-20-7-9-21/h1-3,12,15,20H,4-11H2/t15-/m0/s1 |
| InChIKey | UURKUNPMOBFGPA-HNNXBMFYSA-N |
| XLogP | 2.38 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |