C16H22F2N2O2 — CID 171170924
1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-methylbutyl]piperazine (PubChem CID 171170924) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-methylbutyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171170924 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@H](c1cccc2c1OC(F)(F)O2)N1CCNCC1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-11(2)10-13(20-8-6-19-7-9-20)12-4-3-5-14-15(12)22-16(17,18)21-14/h3-5,11,13,19H,6-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | TYYFDARJXAFBCY-CYBMUJFWSA-N |
| XLogP | 3.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |