C16H22Cl2F2N2O2 — CID 171279293
1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171279293) has the molecular formula C16H22Cl2F2N2O2 and a molecular weight of 383.27 g/mol. Its IUPAC name is 1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279293 |
| Molecular Formula | C16H22Cl2F2N2O2 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@@H](c1cccc2c1OC(F)(F)O2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H20F2N2O2.2ClH/c1-2-3-6-13(20-10-8-19-9-11-20)12-5-4-7-14-15(12)22-16(17,18)21-14;;/h2,4-5,7,13,19H,1,3,6,8-11H2;2*1H/t13-;;/m0../s1 |
| InChIKey | WOZGERPXXJTYSO-GXKRWWSZSA-N |
| XLogP | 3.76 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|