C11H12ClF2NO2 — CID 171207846
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride (PubChem CID 171207846) has the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. Its IUPAC name is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171207846 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cccc2c1OC(F)(F)O2.Cl |
| InChI | InChI=1S/C11H11F2NO2.ClH/c1-2-4-8(14)7-5-3-6-9-10(7)16-11(12,13)15-9;/h2-3,5-6,8H,1,4,14H2;1H/t8-;/m1./s1 |
| InChIKey | PSRSRQLMNJEAND-DDWIOCJRSA-N |
| XLogP | 3.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|