About (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride (PubChem CID 171207846) has the molecular formula C11H12ClF2NO2
and a molecular weight of 263.67 g/mol. Its IUPAC name is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride |
| PubChem CID | 171207846 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cccc2c1OC(F)(F)O2.Cl |
| InChI | InChI=1S/C11H11F2NO2.ClH/c1-2-4-8(14)7-5-3-6-9-10(7)16-11(12,13)15-9;/h2-3,5-6,8H,1,4,14H2;1H/t8-;/m1./s1 |
| InChIKey | PSRSRQLMNJEAND-DDWIOCJRSA-N |
| XLogP | 3.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride?
The IUPAC name of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride (CID 171207846) is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride.
What is the SMILES notation for (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride?
The canonical SMILES for (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride is C=CC[C@@H](N)c1cccc2c1OC(F)(F)O2.Cl.
What is the InChIKey of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride?
The InChIKey is PSRSRQLMNJEAND-DDWIOCJRSA-N. The full InChI is InChI=1S/C11H11F2NO2.ClH/c1-2-4-8(14)7-5-3-6-9-10(7)16-11(12,13)15-9;/h2-3,5-6,8H,1,4,14H2;1H/t8-;/m1./s1.
What are the key properties of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride?
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride has a molecular weight of 263.67 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-en-1-amine;hydrochloride is sourced from PubChem (CID 171207846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).