C11H8F2O5 — CID 82665423
methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate (PubChem CID 82665423) has the molecular formula C11H8F2O5 and a molecular weight of 258.18 g/mol. Its IUPAC name is methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82665423 |
| Molecular Formula | C11H8F2O5 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C11H8F2O5/c1-16-9(15)5-7(14)6-3-2-4-8-10(6)18-11(12,13)17-8/h2-4H,5H2,1H3 |
| InChIKey | RVTIZPYFSXWWLI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|