methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate

C11H8F2O5 — CID 82665423

IUPACmethyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate
SMILESCOC(=O)CC(=O)c1cccc2c1OC(F)(F)O2
InChIInChI=1S/C11H8F2O5/c1-16-9(15)5-7(14)6-3-2-4-8-10(6)18-11(12,13)17-8/h2-4H,5H2,1H3
InChIKeyRVTIZPYFSXWWLI-UHFFFAOYSA-N
MW258.18 g/mol
LogP1.75
Rot. Bonds3

About methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate

methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate (PubChem CID 82665423) has the molecular formula C11H8F2O5 and a molecular weight of 258.18 g/mol. Its IUPAC name is methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate.

Molecular Properties

Compound Namemethyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate
PubChem CID82665423
Molecular FormulaC11H8F2O5
Molecular Weight258.18 g/mol
Exact Mass258.03
IUPAC Namemethyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate
SMILESCOC(=O)CC(=O)c1cccc2c1OC(F)(F)O2
InChIInChI=1S/C11H8F2O5/c1-16-9(15)5-7(14)6-3-2-4-8-10(6)18-11(12,13)17-8/h2-4H,5H2,1H3
InChIKeyRVTIZPYFSXWWLI-UHFFFAOYSA-N
XLogP1.75
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.18
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate?
The IUPAC name of methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate (CID 82665423) is methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate.
What is the SMILES notation for methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate?
The canonical SMILES for methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate is COC(=O)CC(=O)c1cccc2c1OC(F)(F)O2.
What is the InChIKey of methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate?
The InChIKey is RVTIZPYFSXWWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2O5/c1-16-9(15)5-7(14)6-3-2-4-8-10(6)18-11(12,13)17-8/h2-4H,5H2,1H3.
What are the key properties of methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate?
methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate has a molecular weight of 258.18 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-oxopropanoate is sourced from PubChem (CID 82665423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).