C22H18F2N2O6 — CID 162385222
methyl (2E)-2-[2-[[(E)-4-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-yn-2-ylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 162385222) has the molecular formula C22H18F2N2O6 and a molecular weight of 444.39 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[(E)-4-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-yn-2-ylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[(E)-4-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-yn-2-ylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 162385222 |
| Molecular Formula | C22H18F2N2O6 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | methyl (2E)-2-[2-[[(E)-4-(2,2-difluoro-1,3-benzodioxol-4-yl)but-3-yn-2-ylideneamino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1CO/N=C(\C)C#Cc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C22H18F2N2O6/c1-14(11-12-15-8-6-10-18-20(15)32-22(23,24)31-18)25-30-13-16-7-4-5-9-17(16)19(26-29-3)21(27)28-2/h4-10H,13H2,1-3H3/b25-14+,26-19+ |
| InChIKey | RECQZRDRAWEJPT-VJPJFNPUSA-N |
| XLogP | 3.48 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|