C9H5F2IO4 — CID 162609009
methyl 2,2-difluoro-6-iodo-1,3-benzodioxole-4-carboxylate (PubChem CID 162609009) has the molecular formula C9H5F2IO4 and a molecular weight of 342.04 g/mol. Its IUPAC name is methyl 2,2-difluoro-6-iodo-1,3-benzodioxole-4-carboxylate.
| Compound Name | methyl 2,2-difluoro-6-iodo-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 162609009 |
| Molecular Formula | C9H5F2IO4 |
| Molecular Weight | 342.04 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | methyl 2,2-difluoro-6-iodo-1,3-benzodioxole-4-carboxylate |
| SMILES | COC(=O)c1cc(I)cc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C9H5F2IO4/c1-14-8(13)5-2-4(12)3-6-7(5)16-9(10,11)15-6/h2-3H,1H3 |
| InChIKey | HFKLGQBRWJJACZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.04 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|