C17H10F4O5 — CID 154169130
bis(2,2-difluoro-4-methyl-1,3-benzodioxol-5-yl)methanone (PubChem CID 154169130) has the molecular formula C17H10F4O5 and a molecular weight of 370.25 g/mol. Its IUPAC name is bis(2,2-difluoro-4-methyl-1,3-benzodioxol-5-yl)methanone.
| Compound Name | bis(2,2-difluoro-4-methyl-1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 154169130 |
| Molecular Formula | C17H10F4O5 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | bis(2,2-difluoro-4-methyl-1,3-benzodioxol-5-yl)methanone |
| SMILES | Cc1c(C(=O)c2ccc3c(c2C)OC(F)(F)O3)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C17H10F4O5/c1-7-9(3-5-11-14(7)25-16(18,19)23-11)13(22)10-4-6-12-15(8(10)2)26-17(20,21)24-12/h3-6H,1-2H3 |
| InChIKey | DJJZUKAREVJDLR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |