C15H14F2O4 — CID 54163175
1-cyclopropyl-3-(4-ethyl-2,2-difluoro-1,3-benzodioxol-5-yl)propane-1,3-dione (PubChem CID 54163175) has the molecular formula C15H14F2O4 and a molecular weight of 296.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-ethyl-2,2-difluoro-1,3-benzodioxol-5-yl)propane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-(4-ethyl-2,2-difluoro-1,3-benzodioxol-5-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 54163175 |
| Molecular Formula | C15H14F2O4 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-cyclopropyl-3-(4-ethyl-2,2-difluoro-1,3-benzodioxol-5-yl)propane-1,3-dione |
| SMILES | CCc1c(C(=O)CC(=O)C2CC2)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C15H14F2O4/c1-2-9-10(12(19)7-11(18)8-3-4-8)5-6-13-14(9)21-15(16,17)20-13/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | OPVLSANACUFIHK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|