C10H9F2NO4 — CID 167740632
ethyl 5-amino-2,2-difluoro-1,3-benzodioxole-4-carboxylate (PubChem CID 167740632) has the molecular formula C10H9F2NO4 and a molecular weight of 245.18 g/mol. Its IUPAC name is ethyl 5-amino-2,2-difluoro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl 5-amino-2,2-difluoro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 167740632 |
| Molecular Formula | C10H9F2NO4 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | ethyl 5-amino-2,2-difluoro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)c1c(N)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C10H9F2NO4/c1-2-15-9(14)7-5(13)3-4-6-8(7)17-10(11,12)16-6/h3-4H,2,13H2,1H3 |
| InChIKey | LMELIBMUOXYALO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|