C10H7BrF2O4 — CID 18989164
methyl 4-(bromomethyl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate (PubChem CID 18989164) has the molecular formula C10H7BrF2O4 and a molecular weight of 309.06 g/mol. Its IUPAC name is methyl 4-(bromomethyl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 4-(bromomethyl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18989164 |
| Molecular Formula | C10H7BrF2O4 |
| Molecular Weight | 309.06 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | methyl 4-(bromomethyl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1CBr)OC(F)(F)O2 |
| InChI | InChI=1S/C10H7BrF2O4/c1-15-9(14)5-2-3-7-8(6(5)4-11)17-10(12,13)16-7/h2-3H,4H2,1H3 |
| InChIKey | NXXLXCSKDJNVHZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.06 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|