C15H19BrO4 — CID 14276361
tert-butyl 4-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole-5-carboxylate (PubChem CID 14276361) has the molecular formula C15H19BrO4 and a molecular weight of 343.22 g/mol. Its IUPAC name is tert-butyl 4-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole-5-carboxylate.
| Compound Name | tert-butyl 4-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 14276361 |
| Molecular Formula | C15H19BrO4 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | tert-butyl 4-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1CBr)OC(C)(C)O2 |
| InChI | InChI=1S/C15H19BrO4/c1-14(2,3)20-13(17)9-6-7-11-12(10(9)8-16)19-15(4,5)18-11/h6-7H,8H2,1-5H3 |
| InChIKey | WFGYXJKWLICXSW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|