C21H22O6 — CID 159395037
(2,2-dimethyl-1,3-benzodioxol-5-yl) 4-(2,2-dimethylpropanoyloxy)benzoate (PubChem CID 159395037) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-benzodioxol-5-yl) 4-(2,2-dimethylpropanoyloxy)benzoate.
| Compound Name | (2,2-dimethyl-1,3-benzodioxol-5-yl) 4-(2,2-dimethylpropanoyloxy)benzoate |
|---|---|
| PubChem CID | 159395037 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2,2-dimethyl-1,3-benzodioxol-5-yl) 4-(2,2-dimethylpropanoyloxy)benzoate |
| SMILES | CC1(C)Oc2ccc(OC(=O)c3ccc(OC(=O)C(C)(C)C)cc3)cc2O1 |
| InChI | InChI=1S/C21H22O6/c1-20(2,3)19(23)25-14-8-6-13(7-9-14)18(22)24-15-10-11-16-17(12-15)27-21(4,5)26-16/h6-12H,1-5H3 |
| InChIKey | LMPHRMWCJXQHHE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|