C18H17BrO4 — CID 53304384
(3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl) 4-bromobenzoate (PubChem CID 53304384) has the molecular formula C18H17BrO4 and a molecular weight of 377.23 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl) 4-bromobenzoate.
| Compound Name | (3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl) 4-bromobenzoate |
|---|---|
| PubChem CID | 53304384 |
| Molecular Formula | C18H17BrO4 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl) 4-bromobenzoate |
| SMILES | CC1(C)Oc2cc(OC(=O)c3ccc(Br)cc3)ccc2CC1O |
| InChI | InChI=1S/C18H17BrO4/c1-18(2)16(20)9-12-5-8-14(10-15(12)23-18)22-17(21)11-3-6-13(19)7-4-11/h3-8,10,16,20H,9H2,1-2H3 |
| InChIKey | CMEPYQARTSTIIY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|