About (6-bromonaphthalen-2-yl) 4-ethylbenzoate
(6-bromonaphthalen-2-yl) 4-ethylbenzoate (PubChem CID 4038314) has the molecular formula C19H15BrO2
and a molecular weight of 355.23 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl) 4-ethylbenzoate.
Molecular Properties
| Compound Name | (6-bromonaphthalen-2-yl) 4-ethylbenzoate |
| PubChem CID | 4038314 |
| Molecular Formula | C19H15BrO2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | (6-bromonaphthalen-2-yl) 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc3cc(Br)ccc3c2)cc1 |
| InChI | InChI=1S/C19H15BrO2/c1-2-13-3-5-14(6-4-13)19(21)22-18-10-8-15-11-17(20)9-7-16(15)12-18/h3-12H,2H2,1H3 |
| InChIKey | SMHNNTBPYRRTJE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-bromonaphthalen-2-yl) 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromonaphthalen-2-yl) 4-ethylbenzoate?
The IUPAC name of (6-bromonaphthalen-2-yl) 4-ethylbenzoate (CID 4038314) is (6-bromonaphthalen-2-yl) 4-ethylbenzoate.
What is the SMILES notation for (6-bromonaphthalen-2-yl) 4-ethylbenzoate?
The canonical SMILES for (6-bromonaphthalen-2-yl) 4-ethylbenzoate is CCc1ccc(C(=O)Oc2ccc3cc(Br)ccc3c2)cc1.
What is the InChIKey of (6-bromonaphthalen-2-yl) 4-ethylbenzoate?
The InChIKey is SMHNNTBPYRRTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrO2/c1-2-13-3-5-14(6-4-13)19(21)22-18-10-8-15-11-17(20)9-7-16(15)12-18/h3-12H,2H2,1H3.
What are the key properties of (6-bromonaphthalen-2-yl) 4-ethylbenzoate?
(6-bromonaphthalen-2-yl) 4-ethylbenzoate has a molecular weight of 355.23 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromonaphthalen-2-yl) 4-ethylbenzoate is sourced from PubChem (CID 4038314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).