About [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane
[3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane (PubChem CID 91445499) has the molecular formula C32H42O4
and a molecular weight of 490.68 g/mol. Its IUPAC name is [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane.
Molecular Properties
| Compound Name | [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane |
| PubChem CID | 91445499 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane |
| SMILES | CC.CC.CCc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(CC)cc3)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C28H30O4.2C2H6/c1-6-19-8-12-21(13-9-19)26(29)31-23-16-17-25(24(18-23)28(3,4)5)32-27(30)22-14-10-20(7-2)11-15-22;2*1-2/h8-18H,6-7H2,1-5H3;2*1-2H3 |
| InChIKey | SVEMJHRMDAJDNQ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane?
The IUPAC name of [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane (CID 91445499) is [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane.
What is the SMILES notation for [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane?
The canonical SMILES for [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane is CC.CC.CCc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(CC)cc3)c(C(C)(C)C)c2)cc1.
What is the InChIKey of [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane?
The InChIKey is SVEMJHRMDAJDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30O4.2C2H6/c1-6-19-8-12-21(13-9-19)26(29)31-23-16-17-25(24(18-23)28(3,4)5)32-27(30)22-14-10-20(7-2)11-15-22;2*1-2/h8-18H,6-7H2,1-5H3;2*1-2H3.
What are the key properties of [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane?
[3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane has a molecular weight of 490.68 g/mol, XLogP of 8.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-tert-butyl-4-(4-ethylbenzoyl)oxyphenyl] 4-ethylbenzoate;ethane is sourced from PubChem (CID 91445499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).