C33H29F3O4 — CID 58309030
[4-[2-[4-(4-ethylbenzoyl)oxyphenyl]-1,1,1-trifluoropropan-2-yl]phenyl] 4-ethylbenzoate (PubChem CID 58309030) has the molecular formula C33H29F3O4 and a molecular weight of 546.59 g/mol. Its IUPAC name is [4-[2-[4-(4-ethylbenzoyl)oxyphenyl]-1,1,1-trifluoropropan-2-yl]phenyl] 4-ethylbenzoate.
| Compound Name | [4-[2-[4-(4-ethylbenzoyl)oxyphenyl]-1,1,1-trifluoropropan-2-yl]phenyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 58309030 |
| Molecular Formula | C33H29F3O4 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | [4-[2-[4-(4-ethylbenzoyl)oxyphenyl]-1,1,1-trifluoropropan-2-yl]phenyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc(C(C)(c3ccc(OC(=O)c4ccc(CC)cc4)cc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H29F3O4/c1-4-22-6-10-24(11-7-22)30(37)39-28-18-14-26(15-19-28)32(3,33(34,35)36)27-16-20-29(21-17-27)40-31(38)25-12-8-23(5-2)9-13-25/h6-21H,4-5H2,1-3H3 |
| InChIKey | SKCFDJMPRNSZBL-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|