C14H14F6O2 — CID 71671873
(4-ethylphenyl) 2,2-bis(trifluoromethyl)butanoate (PubChem CID 71671873) has the molecular formula C14H14F6O2 and a molecular weight of 328.25 g/mol. Its IUPAC name is (4-ethylphenyl) 2,2-bis(trifluoromethyl)butanoate.
| Compound Name | (4-ethylphenyl) 2,2-bis(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 71671873 |
| Molecular Formula | C14H14F6O2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (4-ethylphenyl) 2,2-bis(trifluoromethyl)butanoate |
| SMILES | CCc1ccc(OC(=O)C(CC)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F6O2/c1-3-9-5-7-10(8-6-9)22-11(21)12(4-2,13(15,16)17)14(18,19)20/h5-8H,3-4H2,1-2H3 |
| InChIKey | URTCFVVDBKVZHC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|