About (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate
(4-bromo-2-tert-butylphenyl) 4-propoxybenzoate (PubChem CID 17074476) has the molecular formula C20H23BrO3
and a molecular weight of 391.31 g/mol. Its IUPAC name is (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate.
Molecular Properties
| Compound Name | (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate |
| PubChem CID | 17074476 |
| Molecular Formula | C20H23BrO3 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(Br)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H23BrO3/c1-5-12-23-16-9-6-14(7-10-16)19(22)24-18-11-8-15(21)13-17(18)20(2,3)4/h6-11,13H,5,12H2,1-4H3 |
| InChIKey | KMCXSBQMEGIEJX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate?
The IUPAC name of (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate (CID 17074476) is (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate.
What is the SMILES notation for (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate?
The canonical SMILES for (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate is CCCOc1ccc(C(=O)Oc2ccc(Br)cc2C(C)(C)C)cc1.
What is the InChIKey of (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate?
The InChIKey is KMCXSBQMEGIEJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrO3/c1-5-12-23-16-9-6-14(7-10-16)19(22)24-18-11-8-15(21)13-17(18)20(2,3)4/h6-11,13H,5,12H2,1-4H3.
What are the key properties of (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate?
(4-bromo-2-tert-butylphenyl) 4-propoxybenzoate has a molecular weight of 391.31 g/mol, XLogP of 5.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-tert-butylphenyl) 4-propoxybenzoate is sourced from PubChem (CID 17074476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).