C20H15ClO6 — CID 168599695
[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 168599695) has the molecular formula C20H15ClO6 and a molecular weight of 386.79 g/mol. Its IUPAC name is [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 168599695 |
| Molecular Formula | C20H15ClO6 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(OC(=O)c3ccc(Cl)cc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C20H15ClO6/c1-20(2)26-18(23)16(19(24)27-20)11-12-3-9-15(10-4-12)25-17(22)13-5-7-14(21)8-6-13/h3-11H,1-2H3 |
| InChIKey | DUWHHDCVHZYXRZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|