C23H22O7 — CID 168599678
[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenyl] 4-methylbenzoate (PubChem CID 168599678) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 168599678 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenyl] 4-methylbenzoate |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H22O7/c1-5-27-19-13-15(12-17-21(25)29-23(3,4)30-22(17)26)8-11-18(19)28-20(24)16-9-6-14(2)7-10-16/h6-13H,5H2,1-4H3 |
| InChIKey | MYKUJUNONMWRHH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|