C20H24O8 — CID 168599250
propan-2-yl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate (PubChem CID 168599250) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168599250 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | propan-2-yl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)ccc1OCC(=O)OC(C)C |
| InChI | InChI=1S/C20H24O8/c1-6-24-16-10-13(7-8-15(16)25-11-17(21)26-12(2)3)9-14-18(22)27-20(4,5)28-19(14)23/h7-10,12H,6,11H2,1-5H3 |
| InChIKey | KDCXBCTVMNRVFT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|