C18H21ClO6 — CID 168599437
5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599437) has the molecular formula C18H21ClO6 and a molecular weight of 368.81 g/mol. Its IUPAC name is 5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599437 |
| Molecular Formula | C18H21ClO6 |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C18H21ClO6/c1-6-22-14-9-11(8-13(19)15(14)23-10(2)3)7-12-16(20)24-18(4,5)25-17(12)21/h7-10H,6H2,1-5H3 |
| InChIKey | WCLHFKLRGFJKOY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|