C13H12Cl2O3S — CID 140992618
1-cyclopropyl-3-(3,4-dichloro-2-methylsulfinylphenyl)propane-1,3-dione (PubChem CID 140992618) has the molecular formula C13H12Cl2O3S and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,4-dichloro-2-methylsulfinylphenyl)propane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-(3,4-dichloro-2-methylsulfinylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 140992618 |
| Molecular Formula | C13H12Cl2O3S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1-cyclopropyl-3-(3,4-dichloro-2-methylsulfinylphenyl)propane-1,3-dione |
| SMILES | CS(=O)c1c(C(=O)CC(=O)C2CC2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2O3S/c1-19(18)13-8(4-5-9(14)12(13)15)11(17)6-10(16)7-2-3-7/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | VUDVHNRTPXAVTM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|