C7H6Cl2OS — CID 95212287
1,3-dichloro-2-[(S)-methylsulfinyl]benzene (PubChem CID 95212287) has the molecular formula C7H6Cl2OS and a molecular weight of 209.10 g/mol. Its IUPAC name is 1,3-dichloro-2-[(S)-methylsulfinyl]benzene.
| Compound Name | 1,3-dichloro-2-[(S)-methylsulfinyl]benzene |
|---|---|
| PubChem CID | 95212287 |
| Molecular Formula | C7H6Cl2OS |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 207.95 |
| IUPAC Name | 1,3-dichloro-2-[(S)-methylsulfinyl]benzene |
| SMILES | C[S@](=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H6Cl2OS/c1-11(10)7-5(8)3-2-4-6(7)9/h2-4H,1H3/t11-/m0/s1 |
| InChIKey | FERWOIZMUYDQAV-NSHDSACASA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |