C6H4Cl2O2S — CID 13381876
2,6-dichlorobenzenesulfinic acid (PubChem CID 13381876) has the molecular formula C6H4Cl2O2S and a molecular weight of 211.07 g/mol. Its IUPAC name is 2,6-dichlorobenzenesulfinic acid.
| Compound Name | 2,6-dichlorobenzenesulfinic acid |
|---|---|
| PubChem CID | 13381876 |
| Molecular Formula | C6H4Cl2O2S |
| Molecular Weight | 211.07 g/mol |
| Exact Mass | 209.93 |
| IUPAC Name | 2,6-dichlorobenzenesulfinic acid |
| SMILES | O=S(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C6H4Cl2O2S/c7-4-2-1-3-5(8)6(4)11(9)10/h1-3H,(H,9,10) |
| InChIKey | PXFQJDOKMKEDQY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.07 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|