C8H10O4S — CID 12746143
2,6-dimethoxybenzenesulfinic acid (PubChem CID 12746143) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is 2,6-dimethoxybenzenesulfinic acid.
| Compound Name | 2,6-dimethoxybenzenesulfinic acid |
|---|---|
| PubChem CID | 12746143 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2,6-dimethoxybenzenesulfinic acid |
| SMILES | COc1cccc(OC)c1S(=O)O |
| InChI | InChI=1S/C8H10O4S/c1-11-6-4-3-5-7(12-2)8(6)13(9)10/h3-5H,1-2H3,(H,9,10) |
| InChIKey | OZNINKZOGMORSB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|