C10H14O3S — CID 54447195
2-ethylsulfinyl-1,3-dimethoxybenzene (PubChem CID 54447195) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-ethylsulfinyl-1,3-dimethoxybenzene.
| Compound Name | 2-ethylsulfinyl-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 54447195 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-ethylsulfinyl-1,3-dimethoxybenzene |
| SMILES | CCS(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C10H14O3S/c1-4-14(11)10-8(12-2)6-5-7-9(10)13-3/h5-7H,4H2,1-3H3 |
| InChIKey | VDTWAMJTHPDAGB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |