About CID 102002675
CID 102002675 (PubChem CID 102002675) has the molecular formula C9H9O3
and a molecular weight of 165.17 g/mol.
Molecular Properties
| Compound Name | CID 102002675 |
| PubChem CID | 102002675 |
| Molecular Formula | C9H9O3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | — |
| SMILES | COc1cccc(OC)c1[C]=O |
| InChI | InChI=1S/C9H9O3/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
| InChIKey | SJQJMTRYCRCBDH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 102002675 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102002675?
The IUPAC name of CID 102002675 (CID 102002675) is not available.
What is the SMILES notation for CID 102002675?
The canonical SMILES for CID 102002675 is COc1cccc(OC)c1[C]=O.
What is the InChIKey of CID 102002675?
The InChIKey is SJQJMTRYCRCBDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O3/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3.
What are the key properties of CID 102002675?
CID 102002675 has a molecular weight of 165.17 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102002675 is sourced from PubChem (CID 102002675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).