About 2,6-dimethoxybenzoyl isocyanate
2,6-dimethoxybenzoyl isocyanate (PubChem CID 13321994) has the molecular formula C10H9NO4
and a molecular weight of 207.18 g/mol. Its IUPAC name is 2,6-dimethoxybenzoyl isocyanate.
Molecular Properties
| Compound Name | 2,6-dimethoxybenzoyl isocyanate |
| PubChem CID | 13321994 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2,6-dimethoxybenzoyl isocyanate |
| SMILES | COc1cccc(OC)c1C(=O)N=C=O |
| InChI | InChI=1S/C10H9NO4/c1-14-7-4-3-5-8(15-2)9(7)10(13)11-6-12/h3-5H,1-2H3 |
| InChIKey | RVIZNYIWLZDUJR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethoxybenzoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxybenzoyl isocyanate?
The IUPAC name of 2,6-dimethoxybenzoyl isocyanate (CID 13321994) is 2,6-dimethoxybenzoyl isocyanate.
What is the SMILES notation for 2,6-dimethoxybenzoyl isocyanate?
The canonical SMILES for 2,6-dimethoxybenzoyl isocyanate is COc1cccc(OC)c1C(=O)N=C=O.
What is the InChIKey of 2,6-dimethoxybenzoyl isocyanate?
The InChIKey is RVIZNYIWLZDUJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c1-14-7-4-3-5-8(15-2)9(7)10(13)11-6-12/h3-5H,1-2H3.
What are the key properties of 2,6-dimethoxybenzoyl isocyanate?
2,6-dimethoxybenzoyl isocyanate has a molecular weight of 207.18 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxybenzoyl isocyanate is sourced from PubChem (CID 13321994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).