C12H19O2Te+ — CID 10905938
(2,6-dimethoxyphenyl)-diethyltellanium (PubChem CID 10905938) has the molecular formula C12H19O2Te+ and a molecular weight of 322.88 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-diethyltellanium.
| Compound Name | (2,6-dimethoxyphenyl)-diethyltellanium |
|---|---|
| PubChem CID | 10905938 |
| Molecular Formula | C12H19O2Te+ |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (2,6-dimethoxyphenyl)-diethyltellanium |
| SMILES | CC[Te+](CC)c1c(OC)cccc1OC |
| InChI | InChI=1S/C12H19O2Te/c1-5-15(6-2)12-10(13-3)8-7-9-11(12)14-4/h7-9H,5-6H2,1-4H3/q+1 |
| InChIKey | JVPHNBCKLAGFLR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|