C19H23O5Te+ — CID 101180389
bis(2,6-dimethoxyphenyl)-(2-oxopropyl)tellanium (PubChem CID 101180389) has the molecular formula C19H23O5Te+ and a molecular weight of 458.99 g/mol. Its IUPAC name is bis(2,6-dimethoxyphenyl)-(2-oxopropyl)tellanium.
| Compound Name | bis(2,6-dimethoxyphenyl)-(2-oxopropyl)tellanium |
|---|---|
| PubChem CID | 101180389 |
| Molecular Formula | C19H23O5Te+ |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | bis(2,6-dimethoxyphenyl)-(2-oxopropyl)tellanium |
| SMILES | COc1cccc(OC)c1[Te+](CC(C)=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H23O5Te/c1-13(20)12-25(18-14(21-2)8-6-9-15(18)22-3)19-16(23-4)10-7-11-17(19)24-5/h6-11H,12H2,1-5H3/q+1 |
| InChIKey | OPJCKPWBTKSKOZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|