C10H9ClO2S — CID 63320072
1-(5-chlorothiophen-2-yl)-3-cyclopropylpropane-1,3-dione (PubChem CID 63320072) has the molecular formula C10H9ClO2S and a molecular weight of 228.70 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-cyclopropylpropane-1,3-dione.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-cyclopropylpropane-1,3-dione |
|---|---|
| PubChem CID | 63320072 |
| Molecular Formula | C10H9ClO2S |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-cyclopropylpropane-1,3-dione |
| SMILES | O=C(CC(=O)C1CC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H9ClO2S/c11-10-4-3-9(14-10)8(13)5-7(12)6-1-2-6/h3-4,6H,1-2,5H2 |
| InChIKey | FYFOULWVYLBODZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|