C9H7ClO4S — CID 4962746
methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate (PubChem CID 4962746) has the molecular formula C9H7ClO4S and a molecular weight of 246.67 g/mol. Its IUPAC name is methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 4962746 |
| Molecular Formula | C9H7ClO4S |
| Molecular Weight | 246.67 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | methyl 4-(5-chlorothiophen-2-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H7ClO4S/c1-14-9(13)6(12)4-5(11)7-2-3-8(10)15-7/h2-3H,4H2,1H3 |
| InChIKey | PRBFOJLTYZLZGW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.67 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|