C12H11ClN2O2S — CID 102801743
1-(5-chlorothiophen-2-yl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione (PubChem CID 102801743) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 102801743 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione |
| SMILES | Cc1nn(C)cc1C(=O)CC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7-8(6-15(2)14-7)9(16)5-10(17)11-3-4-12(13)18-11/h3-4,6H,5H2,1-2H3 |
| InChIKey | CHKWYVSZEYZXHD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|