C11H9ClN2O2S — CID 107972662
1-(5-chlorothiophen-2-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione (PubChem CID 107972662) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.73 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 107972662 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione |
| SMILES | Cn1cnc(C(=O)CC(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C11H9ClN2O2S/c1-14-5-7(13-6-14)8(15)4-9(16)10-2-3-11(12)17-10/h2-3,5-6H,4H2,1H3 |
| InChIKey | HFKDUFFULKNLOL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|