C14H12BrClN2O2 — CID 102801790
1-(4-bromo-2-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione (PubChem CID 102801790) has the molecular formula C14H12BrClN2O2 and a molecular weight of 355.62 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 102801790 |
| Molecular Formula | C14H12BrClN2O2 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-(1,3-dimethylpyrazol-4-yl)propane-1,3-dione |
| SMILES | Cc1nn(C)cc1C(=O)CC(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H12BrClN2O2/c1-8-11(7-18(2)17-8)14(20)6-13(19)10-4-3-9(15)5-12(10)16/h3-5,7H,6H2,1-2H3 |
| InChIKey | VGGALZCGAFIFFV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|