C9H8Cl2O2 — CID 50987811
1-(3,4-dichloro-2-hydroxyphenyl)propan-1-one (PubChem CID 50987811) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is 1-(3,4-dichloro-2-hydroxyphenyl)propan-1-one.
| Compound Name | 1-(3,4-dichloro-2-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 50987811 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 1-(3,4-dichloro-2-hydroxyphenyl)propan-1-one |
| SMILES | CCC(=O)c1ccc(Cl)c(Cl)c1O |
| InChI | InChI=1S/C9H8Cl2O2/c1-2-7(12)5-3-4-6(10)8(11)9(5)13/h3-4,13H,2H2,1H3 |
| InChIKey | GTXATAAOUWENOM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |