C10H7Cl2O3- — CID 71651091
2-(3,4-dichloro-2-ethylphenyl)-2-oxoacetate (PubChem CID 71651091) has the molecular formula C10H7Cl2O3- and a molecular weight of 246.07 g/mol. Its IUPAC name is 2-(3,4-dichloro-2-ethylphenyl)-2-oxoacetate.
| Compound Name | 2-(3,4-dichloro-2-ethylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 71651091 |
| Molecular Formula | C10H7Cl2O3- |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 2-(3,4-dichloro-2-ethylphenyl)-2-oxoacetate |
| SMILES | CCc1c(C(=O)C(=O)[O-])ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl2O3/c1-2-5-6(9(13)10(14)15)3-4-7(11)8(5)12/h3-4H,2H2,1H3,(H,14,15)/p-1 |
| InChIKey | CKHCOFUJWAPVHQ-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|